C31H34ClFN4OS — CID 142111437
4-fluorobenzenethiol;trans-(1S,2S)-N-(8-amino-5,6,7,8-tetrahydronaphthalen-2-yl)-2-(4-chlorophenyl)-N-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]cyclopropane-1-carboxamide (PubChem CID 142111437) has the molecular formula C31H34ClFN4OS and a molecular weight of 565.16 g/mol. Its IUPAC name is 4-fluorobenzenethiol;trans-(1S,2S)-N-(8-amino-5,6,7,8-tetrahydronaphthalen-2-yl)-2-(4-chlorophenyl)-N-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 4-fluorobenzenethiol;trans-(1S,2S)-N-(8-amino-5,6,7,8-tetrahydronaphthalen-2-yl)-2-(4-chlorophenyl)-N-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142111437 |
| Molecular Formula | C31H34ClFN4OS |
| Molecular Weight | 565.16 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 4-fluorobenzenethiol;trans-(1S,2S)-N-(8-amino-5,6,7,8-tetrahydronaphthalen-2-yl)-2-(4-chlorophenyl)-N-[(1-methyl-4,5-dihydroimidazol-2-yl)methyl]cyclopropane-1-carboxamide |
| SMILES | CN1CCN=C1CN(C(=O)[C@H]1C[C@@H]1c1ccc(Cl)cc1)c1ccc2c(c1)C(N)CCC2.Fc1ccc(S)cc1 |
| InChI | InChI=1S/C25H29ClN4O.C6H5FS/c1-29-12-11-28-24(29)15-30(19-10-7-16-3-2-4-23(27)21(16)13-19)25(31)22-14-20(22)17-5-8-18(26)9-6-17;7-5-1-3-6(8)4-2-5/h5-10,13,20,22-23H,2-4,11-12,14-15,27H2,1H3;1-4,8H/t20-,22+,23?;/m1./s1 |
| InChIKey | KQPKPNWTIXYERC-UNMQFFQGSA-N |
| XLogP | 6.27 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.16 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|