About N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline
N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline (PubChem CID 142111784) has the molecular formula C16H16ClN
and a molecular weight of 257.76 g/mol. Its IUPAC name is N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline.
Molecular Properties
| Compound Name | N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline |
| PubChem CID | 142111784 |
| Molecular Formula | C16H16ClN |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline |
| SMILES | C=Cc1ccccc1NCC1=CC=C(Cl)C=CC1 |
| InChI | InChI=1S/C16H16ClN/c1-2-14-7-3-4-9-16(14)18-12-13-6-5-8-15(17)11-10-13/h2-5,7-11,18H,1,6,12H2 |
| InChIKey | JXPJEHFKVVZMSN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline?
The IUPAC name of N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline (CID 142111784) is N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline.
What is the SMILES notation for N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline?
The canonical SMILES for N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline is C=Cc1ccccc1NCC1=CC=C(Cl)C=CC1.
What is the InChIKey of N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline?
The InChIKey is JXPJEHFKVVZMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN/c1-2-14-7-3-4-9-16(14)18-12-13-6-5-8-15(17)11-10-13/h2-5,7-11,18H,1,6,12H2.
What are the key properties of N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline?
N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline has a molecular weight of 257.76 g/mol, XLogP of 4.75, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-chlorocyclohepta-1,3,5-trien-1-yl)methyl]-2-ethenylaniline is sourced from PubChem (CID 142111784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).