C22H34N2O — CID 142111929
(1Z)-1-[3,3-dimethyl-7-(methylaminomethyl)-2,4-dihydroisoquinolin-1-ylidene]-3-ethylheptan-2-one (PubChem CID 142111929) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is (1Z)-1-[3,3-dimethyl-7-(methylaminomethyl)-2,4-dihydroisoquinolin-1-ylidene]-3-ethylheptan-2-one.
| Compound Name | (1Z)-1-[3,3-dimethyl-7-(methylaminomethyl)-2,4-dihydroisoquinolin-1-ylidene]-3-ethylheptan-2-one |
|---|---|
| PubChem CID | 142111929 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | (1Z)-1-[3,3-dimethyl-7-(methylaminomethyl)-2,4-dihydroisoquinolin-1-ylidene]-3-ethylheptan-2-one |
| SMILES | CCCCC(CC)C(=O)/C=C1\NC(C)(C)Cc2ccc(CNC)cc21 |
| InChI | InChI=1S/C22H34N2O/c1-6-8-9-17(7-2)21(25)13-20-19-12-16(15-23-5)10-11-18(19)14-22(3,4)24-20/h10-13,17,23-24H,6-9,14-15H2,1-5H3/b20-13- |
| InChIKey | KYDQLMZWSMODLZ-MOSHPQCFSA-N |
| XLogP | 4.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|