About 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane
3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane (PubChem CID 142112018) has the molecular formula C22H48O2
and a molecular weight of 344.62 g/mol. Its IUPAC name is 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane.
Molecular Properties
| Compound Name | 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane |
| PubChem CID | 142112018 |
| Molecular Formula | C22H48O2 |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.37 |
| IUPAC Name | 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane |
| SMILES | CCC(CC)C(O)(CC)CC.CCC(CC)OC(CC)(CC)CC |
| InChI | InChI=1S/C12H26O.C10H22O/c1-6-11(7-2)13-12(8-3,9-4)10-5;1-5-9(6-2)10(11,7-3)8-4/h11H,6-10H2,1-5H3;9,11H,5-8H2,1-4H3 |
| InChIKey | SKKYNHOYIMTEIR-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane?
The IUPAC name of 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane (CID 142112018) is 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane.
What is the SMILES notation for 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane?
The canonical SMILES for 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane is CCC(CC)C(O)(CC)CC.CCC(CC)OC(CC)(CC)CC.
What is the InChIKey of 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane?
The InChIKey is SKKYNHOYIMTEIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O.C10H22O/c1-6-11(7-2)13-12(8-3,9-4)10-5;1-5-9(6-2)10(11,7-3)8-4/h11H,6-10H2,1-5H3;9,11H,5-8H2,1-4H3.
What are the key properties of 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane?
3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane has a molecular weight of 344.62 g/mol, XLogP of 7.13, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethylhexan-3-ol;3-ethyl-3-pentan-3-yloxypentane is sourced from PubChem (CID 142112018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).