C38H44N2O6S — CID 142112402
(2S,5R)-5-[2-[2-(3-ethoxy-4-methoxyphenyl)ethylamino]ethyl]-3-[3-[hydroxy(methoxy)methyl]phenyl]-5-methyl-2-(4-phenylmethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 142112402) has the molecular formula C38H44N2O6S and a molecular weight of 656.85 g/mol. Its IUPAC name is (2S,5R)-5-[2-[2-(3-ethoxy-4-methoxyphenyl)ethylamino]ethyl]-3-[3-[hydroxy(methoxy)methyl]phenyl]-5-methyl-2-(4-phenylmethoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2S,5R)-5-[2-[2-(3-ethoxy-4-methoxyphenyl)ethylamino]ethyl]-3-[3-[hydroxy(methoxy)methyl]phenyl]-5-methyl-2-(4-phenylmethoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 142112402 |
| Molecular Formula | C38H44N2O6S |
| Molecular Weight | 656.85 g/mol |
| Exact Mass | 656.29 |
| IUPAC Name | (2S,5R)-5-[2-[2-(3-ethoxy-4-methoxyphenyl)ethylamino]ethyl]-3-[3-[hydroxy(methoxy)methyl]phenyl]-5-methyl-2-(4-phenylmethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(CCNCC[C@@]2(C)S[C@@H](c3ccc(OCc4ccccc4)cc3)N(c3cccc(C(O)OC)c3)C2=O)ccc1OC |
| InChI | InChI=1S/C38H44N2O6S/c1-5-45-34-24-27(14-19-33(34)43-3)20-22-39-23-21-38(2)37(42)40(31-13-9-12-30(25-31)36(41)44-4)35(47-38)29-15-17-32(18-16-29)46-26-28-10-7-6-8-11-28/h6-19,24-25,35-36,39,41H,5,20-23,26H2,1-4H3/t35-,36?,38+/m0/s1 |
| InChIKey | FVXGXNJYYHVBLJ-RPWNLYHOSA-N |
| XLogP | 7.07 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.85 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|