C17H19N5O — CID 142112558
(2E)-4-[amino-[2-amino-5-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienal (PubChem CID 142112558) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is (2E)-4-[amino-[2-amino-5-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienal.
| Compound Name | (2E)-4-[amino-[2-amino-5-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienal |
|---|---|
| PubChem CID | 142112558 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (2E)-4-[amino-[2-amino-5-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienal |
| SMILES | C=C(/C=C(C=O)\C=C/C)C(N)c1cc(-c2ncn[nH]2)ccc1N |
| InChI | InChI=1S/C17H19N5O/c1-3-4-12(9-23)7-11(2)16(19)14-8-13(5-6-15(14)18)17-20-10-21-22-17/h3-10,16H,2,18-19H2,1H3,(H,20,21,22)/b4-3-,12-7+ |
| InChIKey | ZVNMOZWCWOWPRB-MJXUXYKOSA-N |
| XLogP | 2.31 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|