About 7a,8-dihydrocyclopropa[i]isoquinoline
7a,8-dihydrocyclopropa[i]isoquinoline (PubChem CID 142112819) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 7a,8-dihydrocyclopropa[i]isoquinoline.
Molecular Properties
| Compound Name | 7a,8-dihydrocyclopropa[i]isoquinoline |
| PubChem CID | 142112819 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 7a,8-dihydrocyclopropa[i]isoquinoline |
| SMILES | C1=CC2CC23C=NC=CC3=C1 |
| InChI | InChI=1S/C10H9N/c1-2-8-4-5-11-7-10(8)6-9(10)3-1/h1-5,7,9H,6H2 |
| InChIKey | NEPQRBSVRVAVHT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7a,8-dihydrocyclopropa[i]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7a,8-dihydrocyclopropa[i]isoquinoline?
The IUPAC name of 7a,8-dihydrocyclopropa[i]isoquinoline (CID 142112819) is 7a,8-dihydrocyclopropa[i]isoquinoline.
What is the SMILES notation for 7a,8-dihydrocyclopropa[i]isoquinoline?
The canonical SMILES for 7a,8-dihydrocyclopropa[i]isoquinoline is C1=CC2CC23C=NC=CC3=C1.
What is the InChIKey of 7a,8-dihydrocyclopropa[i]isoquinoline?
The InChIKey is NEPQRBSVRVAVHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c1-2-8-4-5-11-7-10(8)6-9(10)3-1/h1-5,7,9H,6H2.
What are the key properties of 7a,8-dihydrocyclopropa[i]isoquinoline?
7a,8-dihydrocyclopropa[i]isoquinoline has a molecular weight of 143.19 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7a,8-dihydrocyclopropa[i]isoquinoline is sourced from PubChem (CID 142112819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).