C12H20N2S — CID 142112945
1-(7-methylsulfanylcyclohepta-1,3-dien-1-yl)piperazine (PubChem CID 142112945) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 1-(7-methylsulfanylcyclohepta-1,3-dien-1-yl)piperazine.
| Compound Name | 1-(7-methylsulfanylcyclohepta-1,3-dien-1-yl)piperazine |
|---|---|
| PubChem CID | 142112945 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-(7-methylsulfanylcyclohepta-1,3-dien-1-yl)piperazine |
| SMILES | CSC1CCC=CC=C1N1CCNCC1 |
| InChI | InChI=1S/C12H20N2S/c1-15-12-6-4-2-3-5-11(12)14-9-7-13-8-10-14/h2-3,5,12-13H,4,6-10H2,1H3 |
| InChIKey | OAAQOSPWUCAGLV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |