C12H9FN4O6 — CID 14211295
6-fluoro-8-nitro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-carboxamide (PubChem CID 14211295) has the molecular formula C12H9FN4O6 and a molecular weight of 324.22 g/mol. Its IUPAC name is 6-fluoro-8-nitro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-carboxamide.
| Compound Name | 6-fluoro-8-nitro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-carboxamide |
|---|---|
| PubChem CID | 14211295 |
| Molecular Formula | C12H9FN4O6 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 6-fluoro-8-nitro-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-2-carboxamide |
| SMILES | NC(=O)C1CC2(NC(=O)NC2=O)c2cc(F)cc([N+](=O)[O-])c2O1 |
| InChI | InChI=1S/C12H9FN4O6/c13-4-1-5-8(6(2-4)17(21)22)23-7(9(14)18)3-12(5)10(19)15-11(20)16-12/h1-2,7H,3H2,(H2,14,18)(H2,15,16,19,20) |
| InChIKey | UAPUZZWPHHYIHL-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|