C15H25N — CID 142113019
ethane;4-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 142113019) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is ethane;4-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-1-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | ethane;4-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-1-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 142113019 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | ethane;4-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | C/C=C\C=C/C=C/C1=CCN(C)CC1.CC |
| InChI | InChI=1S/C13H19N.C2H6/c1-3-4-5-6-7-8-13-9-11-14(2)12-10-13;1-2/h3-9H,10-12H2,1-2H3;1-2H3/b4-3-,6-5-,8-7+; |
| InChIKey | GEFSMXJJLHLFTB-ZZJXELOHSA-N |
| XLogP | 3.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|