C10H17NS — CID 142113150
ethane;N-[(1E,3Z)-hexa-1,3,5-trienyl]ethanethioamide (PubChem CID 142113150) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is ethane;N-[(1E,3Z)-hexa-1,3,5-trienyl]ethanethioamide.
| Compound Name | ethane;N-[(1E,3Z)-hexa-1,3,5-trienyl]ethanethioamide |
|---|---|
| PubChem CID | 142113150 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | ethane;N-[(1E,3Z)-hexa-1,3,5-trienyl]ethanethioamide |
| SMILES | C=C/C=C\C=C\NC(C)=S.CC |
| InChI | InChI=1S/C8H11NS.C2H6/c1-3-4-5-6-7-9-8(2)10;1-2/h3-7H,1H2,2H3,(H,9,10);1-2H3/b5-4-,7-6+; |
| InChIKey | HFTZZKVMMQUNMN-YLKXMWBMSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|