C12H21N — CID 142113185
(4E,6E)-N,N-diethylocta-1,4,6-trien-4-amine (PubChem CID 142113185) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (4E,6E)-N,N-diethylocta-1,4,6-trien-4-amine.
| Compound Name | (4E,6E)-N,N-diethylocta-1,4,6-trien-4-amine |
|---|---|
| PubChem CID | 142113185 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (4E,6E)-N,N-diethylocta-1,4,6-trien-4-amine |
| SMILES | C=CC/C(=C\C=C\C)N(CC)CC |
| InChI | InChI=1S/C12H21N/c1-5-9-11-12(10-6-2)13(7-3)8-4/h5-6,9,11H,2,7-8,10H2,1,3-4H3/b9-5+,12-11+ |
| InChIKey | CIQNCDBDGKVFCW-LCXVDEDSSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|