C25H29FINOS2 — CID 142113302
1-[4-[4-(4-fluorophenyl)-1,6,7-trimethyl-7λ3-ioda-2,5-dithiabicyclo[4.1.0]hept-3-en-3-yl]phenyl]-4-methoxypiperidine (PubChem CID 142113302) has the molecular formula C25H29FINOS2 and a molecular weight of 569.55 g/mol. Its IUPAC name is 1-[4-[4-(4-fluorophenyl)-1,6,7-trimethyl-7λ3-ioda-2,5-dithiabicyclo[4.1.0]hept-3-en-3-yl]phenyl]-4-methoxypiperidine.
| Compound Name | 1-[4-[4-(4-fluorophenyl)-1,6,7-trimethyl-7λ3-ioda-2,5-dithiabicyclo[4.1.0]hept-3-en-3-yl]phenyl]-4-methoxypiperidine |
|---|---|
| PubChem CID | 142113302 |
| Molecular Formula | C25H29FINOS2 |
| Molecular Weight | 569.55 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | 1-[4-[4-(4-fluorophenyl)-1,6,7-trimethyl-7λ3-ioda-2,5-dithiabicyclo[4.1.0]hept-3-en-3-yl]phenyl]-4-methoxypiperidine |
| SMILES | COC1CCN(c2ccc(C3=C(c4ccc(F)cc4)SC4(C)I(C)C4(C)S3)cc2)CC1 |
| InChI | InChI=1S/C25H29FINOS2/c1-24-25(2,27(24)3)31-23(22(30-24)17-5-9-19(26)10-6-17)18-7-11-20(12-8-18)28-15-13-21(29-4)14-16-28/h5-12,21H,13-16H2,1-4H3 |
| InChIKey | RJWYSOABZFOXRA-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.55 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|