C39H68N4O4 — CID 142113322
[4,8-bis(cyclohexanecarbonyl)-1,4,8,11-tetrazacyclotetradec-1-yl]-cyclohexylmethanone;cycloheptanecarbaldehyde (PubChem CID 142113322) has the molecular formula C39H68N4O4 and a molecular weight of 657.00 g/mol. Its IUPAC name is [4,8-bis(cyclohexanecarbonyl)-1,4,8,11-tetrazacyclotetradec-1-yl]-cyclohexylmethanone;cycloheptanecarbaldehyde.
| Compound Name | [4,8-bis(cyclohexanecarbonyl)-1,4,8,11-tetrazacyclotetradec-1-yl]-cyclohexylmethanone;cycloheptanecarbaldehyde |
|---|---|
| PubChem CID | 142113322 |
| Molecular Formula | C39H68N4O4 |
| Molecular Weight | 657.00 g/mol |
| Exact Mass | 656.52 |
| IUPAC Name | [4,8-bis(cyclohexanecarbonyl)-1,4,8,11-tetrazacyclotetradec-1-yl]-cyclohexylmethanone;cycloheptanecarbaldehyde |
| SMILES | O=C(C1CCCCC1)N1CCCN(C(=O)C2CCCCC2)CCN(C(=O)C2CCCCC2)CCCNCC1.O=CC1CCCCCC1 |
| InChI | InChI=1S/C31H54N4O3.C8H14O/c36-29(26-12-4-1-5-13-26)33-21-11-22-35(31(38)28-16-8-3-9-17-28)25-24-34(20-10-18-32-19-23-33)30(37)27-14-6-2-7-15-27;9-7-8-5-3-1-2-4-6-8/h26-28,32H,1-25H2;7-8H,1-6H2 |
| InChIKey | SOIKXTPOEIFPRX-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.00 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|