C14H24N2 — CID 142113436
acetylene;2-[(Z)-hex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 142113436) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is acetylene;2-[(Z)-hex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | acetylene;2-[(Z)-hex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 142113436 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | acetylene;2-[(Z)-hex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | C#C.CCC/C=C\CC1CCCCC(N)=N1 |
| InChI | InChI=1S/C12H22N2.C2H2/c1-2-3-4-5-8-11-9-6-7-10-12(13)14-11;1-2/h4-5,11H,2-3,6-10H2,1H3,(H2,13,14);1-2H/b5-4-; |
| InChIKey | FUMIGZWJURXANL-MKWAYWHRSA-N |
| XLogP | 3.28 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|