C13H11F3N4O — CID 142113663
3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 142113663) has the molecular formula C13H11F3N4O and a molecular weight of 296.25 g/mol. Its IUPAC name is 3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 142113663 |
| Molecular Formula | C13H11F3N4O |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | FC(F)(F)COc1ccc(C2=NNC3C=CC=CN23)cn1 |
| InChI | InChI=1S/C13H11F3N4O/c14-13(15,16)8-21-11-5-4-9(7-17-11)12-19-18-10-3-1-2-6-20(10)12/h1-7,10,18H,8H2 |
| InChIKey | NBVALCFWVDFBNF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |