C6H8N2O2 — CID 142113909
6-methyl-1,5-dihydro-1,3-diazepine-2,4-dione (PubChem CID 142113909) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 6-methyl-1,5-dihydro-1,3-diazepine-2,4-dione.
| Compound Name | 6-methyl-1,5-dihydro-1,3-diazepine-2,4-dione |
|---|---|
| PubChem CID | 142113909 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 6-methyl-1,5-dihydro-1,3-diazepine-2,4-dione |
| SMILES | CC1=CNC(=O)NC(=O)C1 |
| InChI | InChI=1S/C6H8N2O2/c1-4-2-5(9)8-6(10)7-3-4/h3H,2H2,1H3,(H2,7,8,9,10) |
| InChIKey | UWNVVERQHABQTP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |