C30H49NO2S — CID 142114730
[(3R,8Z,12E)-2,4,8,12-tetramethyl-13-(2-methyl-1,3-thiazol-4-yl)trideca-8,12-dien-3-yl] (E)-2,2-dimethylhept-3-enoate (PubChem CID 142114730) has the molecular formula C30H49NO2S and a molecular weight of 487.79 g/mol. Its IUPAC name is [(3R,8Z,12E)-2,4,8,12-tetramethyl-13-(2-methyl-1,3-thiazol-4-yl)trideca-8,12-dien-3-yl] (E)-2,2-dimethylhept-3-enoate.
| Compound Name | [(3R,8Z,12E)-2,4,8,12-tetramethyl-13-(2-methyl-1,3-thiazol-4-yl)trideca-8,12-dien-3-yl] (E)-2,2-dimethylhept-3-enoate |
|---|---|
| PubChem CID | 142114730 |
| Molecular Formula | C30H49NO2S |
| Molecular Weight | 487.79 g/mol |
| Exact Mass | 487.35 |
| IUPAC Name | [(3R,8Z,12E)-2,4,8,12-tetramethyl-13-(2-methyl-1,3-thiazol-4-yl)trideca-8,12-dien-3-yl] (E)-2,2-dimethylhept-3-enoate |
| SMILES | CCC/C=C/C(C)(C)C(=O)O[C@H](C(C)C)C(C)CCC/C(C)=C\CC/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C30H49NO2S/c1-10-11-12-19-30(8,9)29(32)33-28(22(2)3)25(6)18-14-16-23(4)15-13-17-24(5)20-27-21-34-26(7)31-27/h12,15,19-22,25,28H,10-11,13-14,16-18H2,1-9H3/b19-12+,23-15-,24-20+/t25?,28-/m1/s1 |
| InChIKey | GRCHDOOJRTWVFO-JNFWTCGPSA-N |
| XLogP | 9.34 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.79 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|