C36H61N — CID 142114736
N-[(2Z,4E,8Z)-20-ethenyl-5,9,13,15,17,17,18,21-octamethyl-16-methylidenedocosa-2,4,8,20-tetraen-3-yl]propan-2-imine (PubChem CID 142114736) has the molecular formula C36H61N and a molecular weight of 507.89 g/mol. Its IUPAC name is N-[(2Z,4E,8Z)-20-ethenyl-5,9,13,15,17,17,18,21-octamethyl-16-methylidenedocosa-2,4,8,20-tetraen-3-yl]propan-2-imine.
| Compound Name | N-[(2Z,4E,8Z)-20-ethenyl-5,9,13,15,17,17,18,21-octamethyl-16-methylidenedocosa-2,4,8,20-tetraen-3-yl]propan-2-imine |
|---|---|
| PubChem CID | 142114736 |
| Molecular Formula | C36H61N |
| Molecular Weight | 507.89 g/mol |
| Exact Mass | 507.48 |
| IUPAC Name | N-[(2Z,4E,8Z)-20-ethenyl-5,9,13,15,17,17,18,21-octamethyl-16-methylidenedocosa-2,4,8,20-tetraen-3-yl]propan-2-imine |
| SMILES | C=CC(CC(C)C(C)(C)C(=C)C(C)CC(C)CCC/C(C)=C\CC/C(C)=C/C(=C/C)N=C(C)C)=C(C)C |
| InChI | InChI=1S/C36H61N/c1-15-34(26(3)4)25-32(11)36(13,14)33(12)31(10)23-29(8)21-17-19-28(7)20-18-22-30(9)24-35(16-2)37-27(5)6/h15-16,20,24,29,31-32H,1,12,17-19,21-23,25H2,2-11,13-14H3/b28-20-,30-24+,35-16- |
| InChIKey | XDSNAQJCHZKTPI-NSMOFDEESA-N |
| XLogP | 12.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.89 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|