C10H14S — CID 142115347
(1E,3Z,5Z)-1-prop-1-en-2-ylsulfanylhepta-1,3,5-triene (PubChem CID 142115347) has the molecular formula C10H14S and a molecular weight of 166.29 g/mol. Its IUPAC name is (1E,3Z,5Z)-1-prop-1-en-2-ylsulfanylhepta-1,3,5-triene.
| Compound Name | (1E,3Z,5Z)-1-prop-1-en-2-ylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142115347 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (1E,3Z,5Z)-1-prop-1-en-2-ylsulfanylhepta-1,3,5-triene |
| SMILES | C=C(C)S/C=C/C=C\C=C/C |
| InChI | InChI=1S/C10H14S/c1-4-5-6-7-8-9-11-10(2)3/h4-9H,2H2,1,3H3/b5-4-,7-6-,9-8+ |
| InChIKey | HKELCBOTWNECFR-JCBGPSFGSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|