About [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate
[2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate (PubChem CID 142115559) has the molecular formula C24H23ClF2N4O3
and a molecular weight of 488.92 g/mol. Its IUPAC name is [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate.
Molecular Properties
| Compound Name | [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate |
| PubChem CID | 142115559 |
| Molecular Formula | C24H23ClF2N4O3 |
| Molecular Weight | 488.92 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate |
| SMILES | CCCNCC(=O)OCc1c(Cl)cccc1-c1cccc(N(C(N)=O)c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C24H23ClF2N4O3/c1-2-12-29-13-22(32)34-14-16-15(6-3-7-17(16)25)20-10-5-11-21(30-20)31(24(28)33)23-18(26)8-4-9-19(23)27/h3-11,29H,2,12-14H2,1H3,(H2,28,33) |
| InChIKey | WYBXHVYUBZFOFI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.92 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate?
The IUPAC name of [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate (CID 142115559) is [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate.
What is the SMILES notation for [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate?
The canonical SMILES for [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate is CCCNCC(=O)OCc1c(Cl)cccc1-c1cccc(N(C(N)=O)c2c(F)cccc2F)n1.
What is the InChIKey of [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate?
The InChIKey is WYBXHVYUBZFOFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23ClF2N4O3/c1-2-12-29-13-22(32)34-14-16-15(6-3-7-17(16)25)20-10-5-11-21(30-20)31(24(28)33)23-18(26)8-4-9-19(23)27/h3-11,29H,2,12-14H2,1H3,(H2,28,33).
What are the key properties of [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate?
[2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate has a molecular weight of 488.92 g/mol, XLogP of 4.94, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[6-(N-carbamoyl-2,6-difluoroanilino)-2-pyridinyl]-6-chlorophenyl]methyl 2-(propylamino)acetate is sourced from PubChem (CID 142115559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).