C7H10FN — CID 142115593
3-fluoro-6-methylcyclohexa-1,3-dien-1-amine (PubChem CID 142115593) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is 3-fluoro-6-methylcyclohexa-1,3-dien-1-amine.
| Compound Name | 3-fluoro-6-methylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142115593 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 3-fluoro-6-methylcyclohexa-1,3-dien-1-amine |
| SMILES | CC1CC=C(F)C=C1N |
| InChI | InChI=1S/C7H10FN/c1-5-2-3-6(8)4-7(5)9/h3-5H,2,9H2,1H3 |
| InChIKey | KUKDYFANSWBYBG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |