C13H22O2 — CID 142115726
1-(methoxymethyl)-1-methyl-3-methylidenecyclopentane;1-methoxypropa-1,2-diene (PubChem CID 142115726) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-(methoxymethyl)-1-methyl-3-methylidenecyclopentane;1-methoxypropa-1,2-diene.
| Compound Name | 1-(methoxymethyl)-1-methyl-3-methylidenecyclopentane;1-methoxypropa-1,2-diene |
|---|---|
| PubChem CID | 142115726 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 1-(methoxymethyl)-1-methyl-3-methylidenecyclopentane;1-methoxypropa-1,2-diene |
| SMILES | C=C1CCC(C)(COC)C1.C=C=COC |
| InChI | InChI=1S/C9H16O.C4H6O/c1-8-4-5-9(2,6-8)7-10-3;1-3-4-5-2/h1,4-7H2,2-3H3;4H,1H2,2H3 |
| InChIKey | BIUGEHXEYHNYJG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|