C24H35NO2 — CID 142115959
1-ethyl-3-[3-methyl-5-[(1Z,4Z,6Z)-nona-1,4,6-trien-8-ynyl]azepan-1-yl]cyclopentane-1-carboxylic acid (PubChem CID 142115959) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is 1-ethyl-3-[3-methyl-5-[(1Z,4Z,6Z)-nona-1,4,6-trien-8-ynyl]azepan-1-yl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-ethyl-3-[3-methyl-5-[(1Z,4Z,6Z)-nona-1,4,6-trien-8-ynyl]azepan-1-yl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 142115959 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | 1-ethyl-3-[3-methyl-5-[(1Z,4Z,6Z)-nona-1,4,6-trien-8-ynyl]azepan-1-yl]cyclopentane-1-carboxylic acid |
| SMILES | C#C/C=C\C=C/C/C=C\C1CCN(C2CCC(CC)(C(=O)O)C2)CC(C)C1 |
| InChI | InChI=1S/C24H35NO2/c1-4-6-7-8-9-10-11-12-21-14-16-25(19-20(3)17-21)22-13-15-24(5-2,18-22)23(26)27/h1,6-9,11-12,20-22H,5,10,13-19H2,2-3H3,(H,26,27)/b7-6-,9-8-,12-11- |
| InChIKey | WRZUQWDEDCZAAE-SLGZOPHFSA-N |
| XLogP | 5.06 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|