C17H25NO2 — CID 142116001
ethane;1-[2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-3-phenylpropan-1-one (PubChem CID 142116001) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is ethane;1-[2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-3-phenylpropan-1-one.
| Compound Name | ethane;1-[2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 142116001 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | ethane;1-[2-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-3-phenylpropan-1-one |
| SMILES | CC.O=C(CCc1ccccc1)N1CC2CC2C1CO |
| InChI | InChI=1S/C15H19NO2.C2H6/c17-10-14-13-8-12(13)9-16(14)15(18)7-6-11-4-2-1-3-5-11;1-2/h1-5,12-14,17H,6-10H2;1-2H3 |
| InChIKey | ZTVJBCUMMJYDFA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |