C8H7ClN2O — CID 14211659
5-chloro-6-ethyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 14211659) has the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. Its IUPAC name is 5-chloro-6-ethyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-ethyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 14211659 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 5-chloro-6-ethyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | CCc1[nH]c(=O)c(C#N)cc1Cl |
| InChI | InChI=1S/C8H7ClN2O/c1-2-7-6(9)3-5(4-10)8(12)11-7/h3H,2H2,1H3,(H,11,12) |
| InChIKey | ONYCNLWPHXFNLL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |