C27H37ClN4O4 — CID 142117183
N-[(2R)-3-(4-chlorophenyl)-1-[4-cyclohexyl-4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]piperidin-1-yl]-1-oxopropan-2-yl]formamide (PubChem CID 142117183) has the molecular formula C27H37ClN4O4 and a molecular weight of 517.07 g/mol. Its IUPAC name is N-[(2R)-3-(4-chlorophenyl)-1-[4-cyclohexyl-4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]piperidin-1-yl]-1-oxopropan-2-yl]formamide.
| Compound Name | N-[(2R)-3-(4-chlorophenyl)-1-[4-cyclohexyl-4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]piperidin-1-yl]-1-oxopropan-2-yl]formamide |
|---|---|
| PubChem CID | 142117183 |
| Molecular Formula | C27H37ClN4O4 |
| Molecular Weight | 517.07 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | N-[(2R)-3-(4-chlorophenyl)-1-[4-cyclohexyl-4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]piperidin-1-yl]-1-oxopropan-2-yl]formamide |
| SMILES | CC1(C)NC(=O)N(CC2(C3CCCCC3)CCN(C(=O)[C@@H](Cc3ccc(Cl)cc3)NC=O)CC2)C1=O |
| InChI | InChI=1S/C27H37ClN4O4/c1-26(2)24(35)32(25(36)30-26)17-27(20-6-4-3-5-7-20)12-14-31(15-13-27)23(34)22(29-18-33)16-19-8-10-21(28)11-9-19/h8-11,18,20,22H,3-7,12-17H2,1-2H3,(H,29,33)(H,30,36)/t22-/m1/s1 |
| InChIKey | LLWPSDKAFIBVTK-JOCHJYFZSA-N |
| XLogP | 3.52 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.07 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|