About N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide
N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide (PubChem CID 142117227) has the molecular formula C22H45N3O4
and a molecular weight of 415.62 g/mol. Its IUPAC name is N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide.
Molecular Properties
| Compound Name | N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide |
| PubChem CID | 142117227 |
| Molecular Formula | C22H45N3O4 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.34 |
| IUPAC Name | N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide |
| SMILES | CC(=O)N1CCOCC1.CCCCCN(CCC)C(C)=O.CCCCNC(C)=O |
| InChI | InChI=1S/C10H21NO.C6H11NO2.C6H13NO/c1-4-6-7-9-11(8-5-2)10(3)12;1-6(8)7-2-4-9-5-3-7;1-3-4-5-7-6(2)8/h4-9H2,1-3H3;2-5H2,1H3;3-5H2,1-2H3,(H,7,8) |
| InChIKey | WRTGYRJDTHTLIH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide?
The IUPAC name of N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide (CID 142117227) is N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide.
What is the SMILES notation for N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide?
The canonical SMILES for N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide is CC(=O)N1CCOCC1.CCCCCN(CCC)C(C)=O.CCCCNC(C)=O.
What is the InChIKey of N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide?
The InChIKey is WRTGYRJDTHTLIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO.C6H11NO2.C6H13NO/c1-4-6-7-9-11(8-5-2)10(3)12;1-6(8)7-2-4-9-5-3-7;1-3-4-5-7-6(2)8/h4-9H2,1-3H3;2-5H2,1H3;3-5H2,1-2H3,(H,7,8).
What are the key properties of N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide?
N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide has a molecular weight of 415.62 g/mol, XLogP of 3.22, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylacetamide;1-morpholin-4-ylethanone;N-pentyl-N-propylacetamide is sourced from PubChem (CID 142117227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).