About 5,6-dihydro-1,3-benzoxathiole;ethane;propane
5,6-dihydro-1,3-benzoxathiole;ethane;propane (PubChem CID 142117399) has the molecular formula C14H28OS
and a molecular weight of 244.44 g/mol. Its IUPAC name is 5,6-dihydro-1,3-benzoxathiole;ethane;propane.
Molecular Properties
| Compound Name | 5,6-dihydro-1,3-benzoxathiole;ethane;propane |
| PubChem CID | 142117399 |
| Molecular Formula | C14H28OS |
| Molecular Weight | 244.44 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 5,6-dihydro-1,3-benzoxathiole;ethane;propane |
| SMILES | C1=C2OCSC2=CCC1.CC.CC.CCC |
| InChI | InChI=1S/C7H8OS.C3H8.2C2H6/c1-2-4-7-6(3-1)8-5-9-7;1-3-2;2*1-2/h3-4H,1-2,5H2;3H2,1-2H3;2*1-2H3 |
| InChIKey | DXRZEGOCDRSZMM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydro-1,3-benzoxathiole;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-1,3-benzoxathiole;ethane;propane?
The IUPAC name of 5,6-dihydro-1,3-benzoxathiole;ethane;propane (CID 142117399) is 5,6-dihydro-1,3-benzoxathiole;ethane;propane.
What is the SMILES notation for 5,6-dihydro-1,3-benzoxathiole;ethane;propane?
The canonical SMILES for 5,6-dihydro-1,3-benzoxathiole;ethane;propane is C1=C2OCSC2=CCC1.CC.CC.CCC.
What is the InChIKey of 5,6-dihydro-1,3-benzoxathiole;ethane;propane?
The InChIKey is DXRZEGOCDRSZMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS.C3H8.2C2H6/c1-2-4-7-6(3-1)8-5-9-7;1-3-2;2*1-2/h3-4H,1-2,5H2;3H2,1-2H3;2*1-2H3.
What are the key properties of 5,6-dihydro-1,3-benzoxathiole;ethane;propane?
5,6-dihydro-1,3-benzoxathiole;ethane;propane has a molecular weight of 244.44 g/mol, XLogP of 5.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-1,3-benzoxathiole;ethane;propane is sourced from PubChem (CID 142117399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).