C26H29BrN4O2S — CID 142117604
1-[4-(5-bromocyclohepta-1,3,6-trien-1-yl)-4-hydroxypiperidin-1-yl]-2-(4-hydrazinyl-3-methyl-2-sulfanylidene-1-pyridinyl)-2-phenylethanone (PubChem CID 142117604) has the molecular formula C26H29BrN4O2S and a molecular weight of 541.52 g/mol. Its IUPAC name is 1-[4-(5-bromocyclohepta-1,3,6-trien-1-yl)-4-hydroxypiperidin-1-yl]-2-(4-hydrazinyl-3-methyl-2-sulfanylidene-1-pyridinyl)-2-phenylethanone.
| Compound Name | 1-[4-(5-bromocyclohepta-1,3,6-trien-1-yl)-4-hydroxypiperidin-1-yl]-2-(4-hydrazinyl-3-methyl-2-sulfanylidene-1-pyridinyl)-2-phenylethanone |
|---|---|
| PubChem CID | 142117604 |
| Molecular Formula | C26H29BrN4O2S |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 1-[4-(5-bromocyclohepta-1,3,6-trien-1-yl)-4-hydroxypiperidin-1-yl]-2-(4-hydrazinyl-3-methyl-2-sulfanylidene-1-pyridinyl)-2-phenylethanone |
| SMILES | Cc1c(NN)ccn(C(C(=O)N2CCC(O)(C3=CC=CC(Br)C=C3)CC2)c2ccccc2)c1=S |
| InChI | InChI=1S/C26H29BrN4O2S/c1-18-22(29-28)12-15-31(25(18)34)23(19-6-3-2-4-7-19)24(32)30-16-13-26(33,14-17-30)20-8-5-9-21(27)11-10-20/h2-12,15,21,23,29,33H,13-14,16-17,28H2,1H3 |
| InChIKey | MJPPWMSKQPYWBP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|