C16H17N3O3S — CID 142117643
ethane;2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-5-yl)-2-phenylacetic acid (PubChem CID 142117643) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is ethane;2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-5-yl)-2-phenylacetic acid.
| Compound Name | ethane;2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-5-yl)-2-phenylacetic acid |
|---|---|
| PubChem CID | 142117643 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | ethane;2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-5-yl)-2-phenylacetic acid |
| SMILES | CC.O=C(O)C(c1ccccc1)n1ccc2[nH][nH]c(=O)c2c1=S |
| InChI | InChI=1S/C14H11N3O3S.C2H6/c18-12-10-9(15-16-12)6-7-17(13(10)21)11(14(19)20)8-4-2-1-3-5-8;1-2/h1-7,11H,(H,19,20)(H2,15,16,18);1-2H3 |
| InChIKey | ODOVBRJZOKCWFG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|