About methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane
methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane (PubChem CID 142117745) has the molecular formula C34H44N2
and a molecular weight of 480.74 g/mol. Its IUPAC name is methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane |
| PubChem CID | 142117745 |
| Molecular Formula | C34H44N2 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane |
| SMILES | C.C=C1CCN(c2ccc(-c3ccccc3)cc2)CC1.c1ccc(N2CCC3(CCCC3)CC2)cc1 |
| InChI | InChI=1S/C18H19N.C15H21N.CH4/c1-15-11-13-19(14-12-15)18-9-7-17(8-10-18)16-5-3-2-4-6-16;1-2-6-14(7-3-1)16-12-10-15(11-13-16)8-4-5-9-15;/h2-10H,1,11-14H2;1-3,6-7H,4-5,8-13H2;1H4 |
| InChIKey | ARYBSHZZQNKSLN-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane?
The IUPAC name of methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane (CID 142117745) is methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane.
What is the SMILES notation for methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane?
The canonical SMILES for methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane is C.C=C1CCN(c2ccc(-c3ccccc3)cc2)CC1.c1ccc(N2CCC3(CCCC3)CC2)cc1.
What is the InChIKey of methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane?
The InChIKey is ARYBSHZZQNKSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N.C15H21N.CH4/c1-15-11-13-19(14-12-15)18-9-7-17(8-10-18)16-5-3-2-4-6-16;1-2-6-14(7-3-1)16-12-10-15(11-13-16)8-4-5-9-15;/h2-10H,1,11-14H2;1-3,6-7H,4-5,8-13H2;1H4.
What are the key properties of methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane?
methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane has a molecular weight of 480.74 g/mol, XLogP of 8.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;4-methylidene-1-(4-phenylphenyl)piperidine;8-phenyl-8-azaspiro[4.5]decane is sourced from PubChem (CID 142117745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).