C23H29N5O5 — CID 142118774
(3aS,6aR)-2-[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]but-3-enoyl]-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 142118774) has the molecular formula C23H29N5O5 and a molecular weight of 455.52 g/mol. Its IUPAC name is (3aS,6aR)-2-[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]but-3-enoyl]-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]but-3-enoyl]-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 142118774 |
| Molecular Formula | C23H29N5O5 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | (3aS,6aR)-2-[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]but-3-enoyl]-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | C=C(C)[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C(C)C)C(=O)N1C[C@@H]2C=CC[C@@H]2C1C(=O)O |
| InChI | InChI=1S/C23H29N5O5/c1-12(2)17(26-20(29)16-10-24-8-9-25-16)21(30)27-18(13(3)4)22(31)28-11-14-6-5-7-15(14)19(28)23(32)33/h5-6,8-10,12,14-15,17-19H,3,7,11H2,1-2,4H3,(H,26,29)(H,27,30)(H,32,33)/t14-,15-,17-,18-,19?/m0/s1 |
| InChIKey | VMHRLWFIVKYRLX-DUUFSRSUSA-N |
| XLogP | 0.78 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|