About 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine
4-butan-2-yl-5-chloro-1,3-thiazol-2-amine (PubChem CID 142119110) has the molecular formula C7H11ClN2S
and a molecular weight of 190.70 g/mol. Its IUPAC name is 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine |
| PubChem CID | 142119110 |
| Molecular Formula | C7H11ClN2S |
| Molecular Weight | 190.70 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine |
| SMILES | CCC(C)c1nc(N)sc1Cl |
| InChI | InChI=1S/C7H11ClN2S/c1-3-4(2)5-6(8)11-7(9)10-5/h4H,3H2,1-2H3,(H2,9,10) |
| InChIKey | YELCCKDLHOEFEG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine?
The IUPAC name of 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine (CID 142119110) is 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine.
What is the SMILES notation for 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine?
The canonical SMILES for 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine is CCC(C)c1nc(N)sc1Cl.
What is the InChIKey of 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine?
The InChIKey is YELCCKDLHOEFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN2S/c1-3-4(2)5-6(8)11-7(9)10-5/h4H,3H2,1-2H3,(H2,9,10).
What are the key properties of 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine?
4-butan-2-yl-5-chloro-1,3-thiazol-2-amine has a molecular weight of 190.70 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-5-chloro-1,3-thiazol-2-amine is sourced from PubChem (CID 142119110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).