C9H14S — CID 142119111
(3E)-3-propylsulfanylhexa-1,3,5-triene (PubChem CID 142119111) has the molecular formula C9H14S and a molecular weight of 154.28 g/mol. Its IUPAC name is (3E)-3-propylsulfanylhexa-1,3,5-triene.
| Compound Name | (3E)-3-propylsulfanylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 142119111 |
| Molecular Formula | C9H14S |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | (3E)-3-propylsulfanylhexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)SCCC |
| InChI | InChI=1S/C9H14S/c1-4-7-9(6-3)10-8-5-2/h4,6-7H,1,3,5,8H2,2H3/b9-7+ |
| InChIKey | MKQXLMLCMGCSCZ-VQHVLOKHSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|