C24H29N2PS — CID 142119640
3-[13-methyl-2-(1-methylsulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]propylidenephosphane (PubChem CID 142119640) has the molecular formula C24H29N2PS and a molecular weight of 408.55 g/mol. Its IUPAC name is 3-[13-methyl-2-(1-methylsulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]propylidenephosphane.
| Compound Name | 3-[13-methyl-2-(1-methylsulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]propylidenephosphane |
|---|---|
| PubChem CID | 142119640 |
| Molecular Formula | C24H29N2PS |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[13-methyl-2-(1-methylsulfanylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-9-yl]propylidenephosphane |
| SMILES | [H]/P=C/CCC1=Cc2cc(C)ccc2C(C2CCN(SC)CC2)c2ncccc21 |
| InChI | InChI=1S/C24H29N2PS/c1-17-7-8-21-20(15-17)16-19(5-4-14-27)22-6-3-11-25-24(22)23(21)18-9-12-26(28-2)13-10-18/h3,6-8,11,14-16,18,23,27H,4-5,9-10,12-13H2,1-2H3 |
| InChIKey | XSUCKIVMSRTYPW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|