C14H19FN2 — CID 142120019
N'-[(1E,4E,6Z)-4-fluoro-2,6-dimethylnona-1,4,6,8-tetraenyl]-N-methylideneethanimidamide (PubChem CID 142120019) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is N'-[(1E,4E,6Z)-4-fluoro-2,6-dimethylnona-1,4,6,8-tetraenyl]-N-methylideneethanimidamide.
| Compound Name | N'-[(1E,4E,6Z)-4-fluoro-2,6-dimethylnona-1,4,6,8-tetraenyl]-N-methylideneethanimidamide |
|---|---|
| PubChem CID | 142120019 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | N'-[(1E,4E,6Z)-4-fluoro-2,6-dimethylnona-1,4,6,8-tetraenyl]-N-methylideneethanimidamide |
| SMILES | C=C/C=C(C)\C=C(\F)C/C(C)=C/N=C(\C)N=C |
| InChI | InChI=1S/C14H19FN2/c1-6-7-11(2)8-14(15)9-12(3)10-17-13(4)16-5/h6-8,10H,1,5,9H2,2-4H3/b11-7-,12-10+,14-8+,17-13+ |
| InChIKey | ZBLTVAVVFKPDON-LFIIMMLMSA-N |
| XLogP | 4.39 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|