About 5-butyl-2,3-dimethyl-4H-pyrimidine
5-butyl-2,3-dimethyl-4H-pyrimidine (PubChem CID 142120666) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 5-butyl-2,3-dimethyl-4H-pyrimidine.
Molecular Properties
| Compound Name | 5-butyl-2,3-dimethyl-4H-pyrimidine |
| PubChem CID | 142120666 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 5-butyl-2,3-dimethyl-4H-pyrimidine |
| SMILES | CCCCC1=CN=C(C)N(C)C1 |
| InChI | InChI=1S/C10H18N2/c1-4-5-6-10-7-11-9(2)12(3)8-10/h7H,4-6,8H2,1-3H3 |
| InChIKey | IWPPAVRJKJVEJG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butyl-2,3-dimethyl-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2,3-dimethyl-4H-pyrimidine?
The IUPAC name of 5-butyl-2,3-dimethyl-4H-pyrimidine (CID 142120666) is 5-butyl-2,3-dimethyl-4H-pyrimidine.
What is the SMILES notation for 5-butyl-2,3-dimethyl-4H-pyrimidine?
The canonical SMILES for 5-butyl-2,3-dimethyl-4H-pyrimidine is CCCCC1=CN=C(C)N(C)C1.
What is the InChIKey of 5-butyl-2,3-dimethyl-4H-pyrimidine?
The InChIKey is IWPPAVRJKJVEJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-5-6-10-7-11-9(2)12(3)8-10/h7H,4-6,8H2,1-3H3.
What are the key properties of 5-butyl-2,3-dimethyl-4H-pyrimidine?
5-butyl-2,3-dimethyl-4H-pyrimidine has a molecular weight of 166.27 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2,3-dimethyl-4H-pyrimidine is sourced from PubChem (CID 142120666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).