C17H24FNO — CID 142120872
N-butan-2-yl-N-(4-fluoro-3-methylphenyl)-2,2-dimethylbut-3-enamide (PubChem CID 142120872) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is N-butan-2-yl-N-(4-fluoro-3-methylphenyl)-2,2-dimethylbut-3-enamide.
| Compound Name | N-butan-2-yl-N-(4-fluoro-3-methylphenyl)-2,2-dimethylbut-3-enamide |
|---|---|
| PubChem CID | 142120872 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-butan-2-yl-N-(4-fluoro-3-methylphenyl)-2,2-dimethylbut-3-enamide |
| SMILES | C=CC(C)(C)C(=O)N(c1ccc(F)c(C)c1)C(C)CC |
| InChI | InChI=1S/C17H24FNO/c1-7-13(4)19(16(20)17(5,6)8-2)14-9-10-15(18)12(3)11-14/h8-11,13H,2,7H2,1,3-6H3 |
| InChIKey | MUWPTGJRRMMSFA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|