About 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane
1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane (PubChem CID 142121679) has the molecular formula C18H31NO
and a molecular weight of 277.45 g/mol. Its IUPAC name is 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane.
Molecular Properties
| Compound Name | 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane |
| PubChem CID | 142121679 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane |
| SMILES | CC.CC.CCC(=O)N1CCC(C)(C)c2ccccc21 |
| InChI | InChI=1S/C14H19NO.2C2H6/c1-4-13(16)15-10-9-14(2,3)11-7-5-6-8-12(11)15;2*1-2/h5-8H,4,9-10H2,1-3H3;2*1-2H3 |
| InChIKey | DWSCPDHTXPICQK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane?
The IUPAC name of 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane (CID 142121679) is 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane.
What is the SMILES notation for 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane?
The canonical SMILES for 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane is CC.CC.CCC(=O)N1CCC(C)(C)c2ccccc21.
What is the InChIKey of 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane?
The InChIKey is DWSCPDHTXPICQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO.2C2H6/c1-4-13(16)15-10-9-14(2,3)11-7-5-6-8-12(11)15;2*1-2/h5-8H,4,9-10H2,1-3H3;2*1-2H3.
What are the key properties of 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane?
1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane has a molecular weight of 277.45 g/mol, XLogP of 5.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-dimethyl-2,3-dihydroquinolin-1-yl)propan-1-one;ethane is sourced from PubChem (CID 142121679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).