C9H13NO4 — CID 142122453
methyl 3-acetamido-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 142122453) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is methyl 3-acetamido-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl 3-acetamido-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 142122453 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | methyl 3-acetamido-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=CCC(NC(C)=O)CO1 |
| InChI | InChI=1S/C9H13NO4/c1-6(11)10-7-3-4-8(14-5-7)9(12)13-2/h4,7H,3,5H2,1-2H3,(H,10,11) |
| InChIKey | SRKOWGDAOGDELR-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |