C27H27F5N2O8 — CID 142122469
3-[[(2S)-2-[[2-(5-acetyl-2-methoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,4,5,6-pentafluorophenoxy)pentanoic acid (PubChem CID 142122469) has the molecular formula C27H27F5N2O8 and a molecular weight of 602.51 g/mol. Its IUPAC name is 3-[[(2S)-2-[[2-(5-acetyl-2-methoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,4,5,6-pentafluorophenoxy)pentanoic acid.
| Compound Name | 3-[[(2S)-2-[[2-(5-acetyl-2-methoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,4,5,6-pentafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 142122469 |
| Molecular Formula | C27H27F5N2O8 |
| Molecular Weight | 602.51 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | 3-[[(2S)-2-[[2-(5-acetyl-2-methoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,4,5,6-pentafluorophenoxy)pentanoic acid |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)N[C@H](C(=O)NC(CC(=O)O)C(=O)COc1c(F)c(F)c(F)c(F)c1F)C(C)C |
| InChI | InChI=1S/C27H27F5N2O8/c1-11(2)25(34-18(37)8-14-7-13(12(3)35)5-6-17(14)41-4)27(40)33-15(9-19(38)39)16(36)10-42-26-23(31)21(29)20(28)22(30)24(26)32/h5-7,11,15,25H,8-10H2,1-4H3,(H,33,40)(H,34,37)(H,38,39)/t15?,25-/m0/s1 |
| InChIKey | BJLRRYUOMHHASE-RZNFBWOTSA-N |
| XLogP | 2.88 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|