C18H27N — CID 142122880
1-(cyclohexen-1-yl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-3,6-dihydro-2H-pyridine (PubChem CID 142122880) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(cyclohexen-1-yl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 142122880 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 1-(cyclohexen-1-yl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-3,6-dihydro-2H-pyridine |
| SMILES | C/C=C\C(=C/CC)C1=CCN(C2=CCCCC2)CC1 |
| InChI | InChI=1S/C18H27N/c1-3-8-16(9-4-2)17-12-14-19(15-13-17)18-10-6-5-7-11-18/h3,8-10,12H,4-7,11,13-15H2,1-2H3/b8-3-,16-9+ |
| InChIKey | AKARSFQGOIBOIF-QOWKATRFSA-N |
| XLogP | 4.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|