About 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one
9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one (PubChem CID 142123684) has the molecular formula C9H13N5O
and a molecular weight of 207.24 g/mol. Its IUPAC name is 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one |
| PubChem CID | 142123684 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one |
| SMILES | C=CCNc1nc2c(c(=O)[nH]1)NCN2C |
| InChI | InChI=1S/C9H13N5O/c1-3-4-10-9-12-7-6(8(15)13-9)11-5-14(7)2/h3,11H,1,4-5H2,2H3,(H2,10,12,13,15) |
| InChIKey | GTOFQGPYSVPJSF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one?
The IUPAC name of 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one (CID 142123684) is 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one.
What is the SMILES notation for 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one?
The canonical SMILES for 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one is C=CCNc1nc2c(c(=O)[nH]1)NCN2C.
What is the InChIKey of 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one?
The InChIKey is GTOFQGPYSVPJSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O/c1-3-4-10-9-12-7-6(8(15)13-9)11-5-14(7)2/h3,11H,1,4-5H2,2H3,(H2,10,12,13,15).
What are the key properties of 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one?
9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one has a molecular weight of 207.24 g/mol, XLogP of 0.19, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-2-(prop-2-enylamino)-7,8-dihydro-1H-purin-6-one is sourced from PubChem (CID 142123684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).