C27H48O5 — CID 142124232
ethyl acetate;4-[6-[(6-hydroxy-3a-methyl-3,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-yl)methyl]-2,2,5-trimethylcyclohexyl]butanal (PubChem CID 142124232) has the molecular formula C27H48O5 and a molecular weight of 452.68 g/mol. Its IUPAC name is ethyl acetate;4-[6-[(6-hydroxy-3a-methyl-3,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-yl)methyl]-2,2,5-trimethylcyclohexyl]butanal.
| Compound Name | ethyl acetate;4-[6-[(6-hydroxy-3a-methyl-3,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-yl)methyl]-2,2,5-trimethylcyclohexyl]butanal |
|---|---|
| PubChem CID | 142124232 |
| Molecular Formula | C27H48O5 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.35 |
| IUPAC Name | ethyl acetate;4-[6-[(6-hydroxy-3a-methyl-3,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-yl)methyl]-2,2,5-trimethylcyclohexyl]butanal |
| SMILES | CC1CCC(C)(C)C(CCCC=O)C1CC1OCC2(C)CCC(O)CC12.CCOC(C)=O |
| InChI | InChI=1S/C23H40O3.C4H8O2/c1-16-8-10-22(2,3)19(7-5-6-12-24)18(16)14-21-20-13-17(25)9-11-23(20,4)15-26-21;1-3-6-4(2)5/h12,16-21,25H,5-11,13-15H2,1-4H3;3H2,1-2H3 |
| InChIKey | WDQIPFVSTPVRLV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|