C27H48O5 — CID 142124235
3-[[1-(1-ethoxy-2-hydroxy-1-methoxyethyl)-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]methyl]-3a,7a-dimethyl-1,3,4,5,6,7-hexahydro-2-benzofuran-5-ol (PubChem CID 142124235) has the molecular formula C27H48O5 and a molecular weight of 452.68 g/mol. Its IUPAC name is 3-[[1-(1-ethoxy-2-hydroxy-1-methoxyethyl)-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]methyl]-3a,7a-dimethyl-1,3,4,5,6,7-hexahydro-2-benzofuran-5-ol.
| Compound Name | 3-[[1-(1-ethoxy-2-hydroxy-1-methoxyethyl)-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]methyl]-3a,7a-dimethyl-1,3,4,5,6,7-hexahydro-2-benzofuran-5-ol |
|---|---|
| PubChem CID | 142124235 |
| Molecular Formula | C27H48O5 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.35 |
| IUPAC Name | 3-[[1-(1-ethoxy-2-hydroxy-1-methoxyethyl)-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]methyl]-3a,7a-dimethyl-1,3,4,5,6,7-hexahydro-2-benzofuran-5-ol |
| SMILES | CCOC(CO)(OC)C1CCC2C(CC3OCC4(C)CCC(O)CC34C)C(C)CCC21C |
| InChI | InChI=1S/C27H48O5/c1-7-32-27(16-28,30-6)22-9-8-21-20(18(2)10-13-25(21,22)4)14-23-26(5)15-19(29)11-12-24(26,3)17-31-23/h18-23,28-29H,7-17H2,1-6H3 |
| InChIKey | VJOWVUVSAWCDCU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|