C26H26ClN — CID 142125427
(1Z,3E)-1-(2-chlorophenyl)-3-phenyl-5-(2-propylphenyl)penta-1,3-dien-1-amine (PubChem CID 142125427) has the molecular formula C26H26ClN and a molecular weight of 387.95 g/mol. Its IUPAC name is (1Z,3E)-1-(2-chlorophenyl)-3-phenyl-5-(2-propylphenyl)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-1-(2-chlorophenyl)-3-phenyl-5-(2-propylphenyl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142125427 |
| Molecular Formula | C26H26ClN |
| Molecular Weight | 387.95 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (1Z,3E)-1-(2-chlorophenyl)-3-phenyl-5-(2-propylphenyl)penta-1,3-dien-1-amine |
| SMILES | CCCc1ccccc1C/C=C(\C=C(/N)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C26H26ClN/c1-2-10-20-13-6-7-14-22(20)17-18-23(21-11-4-3-5-12-21)19-26(28)24-15-8-9-16-25(24)27/h3-9,11-16,18-19H,2,10,17,28H2,1H3/b23-18+,26-19- |
| InChIKey | DWRXFSDYDAHWCP-TXVVHMECSA-N |
| XLogP | 6.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.95 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|