About 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane
2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane (PubChem CID 142126192) has the molecular formula C25H33N3O2
and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane.
Molecular Properties
| Compound Name | 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane |
| PubChem CID | 142126192 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane |
| SMILES | C=CC(C)C(=O)O.CCCCC.CNc1nc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C15H13N3.C5H8O2.C5H12/c1-16-15-12-9-5-6-10-13(12)17-14(18-15)11-7-3-2-4-8-11;1-3-4(2)5(6)7;1-3-5-4-2/h2-10H,1H3,(H,16,17,18);3-4H,1H2,2H3,(H,6,7);3-5H2,1-2H3 |
| InChIKey | OESGPCUOKYBHSN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane?
The IUPAC name of 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane (CID 142126192) is 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane.
What is the SMILES notation for 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane?
The canonical SMILES for 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane is C=CC(C)C(=O)O.CCCCC.CNc1nc(-c2ccccc2)nc2ccccc12.
What is the InChIKey of 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane?
The InChIKey is OESGPCUOKYBHSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3.C5H8O2.C5H12/c1-16-15-12-9-5-6-10-13(12)17-14(18-15)11-7-3-2-4-8-11;1-3-4(2)5(6)7;1-3-5-4-2/h2-10H,1H3,(H,16,17,18);3-4H,1H2,2H3,(H,6,7);3-5H2,1-2H3.
What are the key properties of 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane?
2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane has a molecular weight of 407.56 g/mol, XLogP of 6.43, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-3-enoic acid;N-methyl-2-phenylquinazolin-4-amine;pentane is sourced from PubChem (CID 142126192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).