C22H21F3N6 — CID 142126211
N-[6-(2-aminoethyl)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1-ethylindazol-3-amine (PubChem CID 142126211) has the molecular formula C22H21F3N6 and a molecular weight of 426.45 g/mol. Its IUPAC name is N-[6-(2-aminoethyl)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1-ethylindazol-3-amine.
| Compound Name | N-[6-(2-aminoethyl)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1-ethylindazol-3-amine |
|---|---|
| PubChem CID | 142126211 |
| Molecular Formula | C22H21F3N6 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-[6-(2-aminoethyl)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1-ethylindazol-3-amine |
| SMILES | CCn1nc(Nc2cc(CCN)nc(-c3ccccc3C(F)(F)F)n2)c2ccccc21 |
| InChI | InChI=1S/C22H21F3N6/c1-2-31-18-10-6-4-8-16(18)21(30-31)29-19-13-14(11-12-26)27-20(28-19)15-7-3-5-9-17(15)22(23,24)25/h3-10,13H,2,11-12,26H2,1H3,(H,27,28,29,30) |
| InChIKey | AJJOHRMXSISJBO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |