C12H21N2P — CID 142126658
ethane;N-methyl-3-phosphanyl-5,6,7,8-tetrahydroisoquinolin-1-amine (PubChem CID 142126658) has the molecular formula C12H21N2P and a molecular weight of 224.29 g/mol. Its IUPAC name is ethane;N-methyl-3-phosphanyl-5,6,7,8-tetrahydroisoquinolin-1-amine.
| Compound Name | ethane;N-methyl-3-phosphanyl-5,6,7,8-tetrahydroisoquinolin-1-amine |
|---|---|
| PubChem CID | 142126658 |
| Molecular Formula | C12H21N2P |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | ethane;N-methyl-3-phosphanyl-5,6,7,8-tetrahydroisoquinolin-1-amine |
| SMILES | CC.CNc1nc(P)cc2c1CCCC2 |
| InChI | InChI=1S/C10H15N2P.C2H6/c1-11-10-8-5-3-2-4-7(8)6-9(13)12-10;1-2/h6H,2-5,13H2,1H3,(H,11,12);1-2H3 |
| InChIKey | REEPFDQDKYMVDR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|